C19H21FN2O6S2 — CID 55613673
N-(2-ethylsulfonylphenyl)-4-fluoro-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 55613673) has the molecular formula C19H21FN2O6S2 and a molecular weight of 456.52 g/mol. Its IUPAC name is N-(2-ethylsulfonylphenyl)-4-fluoro-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-(2-ethylsulfonylphenyl)-4-fluoro-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 55613673 |
| Molecular Formula | C19H21FN2O6S2 |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | N-(2-ethylsulfonylphenyl)-4-fluoro-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | CCS(=O)(=O)c1ccccc1NC(=O)c1ccc(F)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C19H21FN2O6S2/c1-2-29(24,25)17-6-4-3-5-16(17)21-19(23)14-7-8-15(20)18(13-14)30(26,27)22-9-11-28-12-10-22/h3-8,13H,2,9-12H2,1H3,(H,21,23) |
| InChIKey | NOFJRQUZTGZOCT-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |