C22H18N2O2 — CID 89335733
N-[5-(2,3-dihydroindol-1-yl)-2-formylphenyl]benzamide (PubChem CID 89335733) has the molecular formula C22H18N2O2 and a molecular weight of 342.40 g/mol. Its IUPAC name is N-[5-(2,3-dihydroindol-1-yl)-2-formylphenyl]benzamide.
| Compound Name | N-[5-(2,3-dihydroindol-1-yl)-2-formylphenyl]benzamide |
|---|---|
| PubChem CID | 89335733 |
| Molecular Formula | C22H18N2O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | N-[5-(2,3-dihydroindol-1-yl)-2-formylphenyl]benzamide |
| SMILES | O=Cc1ccc(N2CCc3ccccc32)cc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H18N2O2/c25-15-18-10-11-19(24-13-12-16-6-4-5-9-21(16)24)14-20(18)23-22(26)17-7-2-1-3-8-17/h1-11,14-15H,12-13H2,(H,23,26) |
| InChIKey | WHNLJFJHLWGMSZ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|