About N-[6-(2,3-dihydroindol-1-yl)pyridazin-3-yl]-4-propan-2-ylbenzenesulfonamide
N-[6-(2,3-dihydroindol-1-yl)pyridazin-3-yl]-4-propan-2-ylbenzenesulfonamide (PubChem CID 113046101) has the molecular formula C21H22N4O2S
and a molecular weight of 394.50 g/mol. Its IUPAC name is N-[6-(2,3-dihydroindol-1-yl)pyridazin-3-yl]-4-propan-2-ylbenzenesulfonamide.
Molecular Properties
| Compound Name | N-[6-(2,3-dihydroindol-1-yl)pyridazin-3-yl]-4-propan-2-ylbenzenesulfonamide |
| PubChem CID | 113046101 |
| Molecular Formula | C21H22N4O2S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | N-[6-(2,3-dihydroindol-1-yl)pyridazin-3-yl]-4-propan-2-ylbenzenesulfonamide |
| SMILES | CC(C)c1ccc(S(=O)(=O)Nc2ccc(N3CCc4ccccc43)nn2)cc1 |
| InChI | InChI=1S/C21H22N4O2S/c1-15(2)16-7-9-18(10-8-16)28(26,27)24-20-11-12-21(23-22-20)25-14-13-17-5-3-4-6-19(17)25/h3-12,15H,13-14H2,1-2H3,(H,22,24) |
| InChIKey | FLLBRYWMYWKBLT-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[6-(2,3-dihydroindol-1-yl)pyridazin-3-yl]-4-propan-2-ylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-(2,3-dihydroindol-1-yl)pyridazin-3-yl]-4-propan-2-ylbenzenesulfonamide?
The IUPAC name of N-[6-(2,3-dihydroindol-1-yl)pyridazin-3-yl]-4-propan-2-ylbenzenesulfonamide (CID 113046101) is N-[6-(2,3-dihydroindol-1-yl)pyridazin-3-yl]-4-propan-2-ylbenzenesulfonamide.
What is the SMILES notation for N-[6-(2,3-dihydroindol-1-yl)pyridazin-3-yl]-4-propan-2-ylbenzenesulfonamide?
The canonical SMILES for N-[6-(2,3-dihydroindol-1-yl)pyridazin-3-yl]-4-propan-2-ylbenzenesulfonamide is CC(C)c1ccc(S(=O)(=O)Nc2ccc(N3CCc4ccccc43)nn2)cc1.
What is the InChIKey of N-[6-(2,3-dihydroindol-1-yl)pyridazin-3-yl]-4-propan-2-ylbenzenesulfonamide?
The InChIKey is FLLBRYWMYWKBLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N4O2S/c1-15(2)16-7-9-18(10-8-16)28(26,27)24-20-11-12-21(23-22-20)25-14-13-17-5-3-4-6-19(17)25/h3-12,15H,13-14H2,1-2H3,(H,22,24).
What are the key properties of N-[6-(2,3-dihydroindol-1-yl)pyridazin-3-yl]-4-propan-2-ylbenzenesulfonamide?
N-[6-(2,3-dihydroindol-1-yl)pyridazin-3-yl]-4-propan-2-ylbenzenesulfonamide has a molecular weight of 394.50 g/mol, XLogP of 4.09, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-(2,3-dihydroindol-1-yl)pyridazin-3-yl]-4-propan-2-ylbenzenesulfonamide is sourced from PubChem (CID 113046101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).