C25H34N4S — CID 133149918
1-[6-(2-methylpiperidin-1-yl)-3-pyridinyl]-3-[(1-phenylcyclohexyl)methyl]thiourea (PubChem CID 133149918) has the molecular formula C25H34N4S and a molecular weight of 422.64 g/mol. Its IUPAC name is 1-[6-(2-methylpiperidin-1-yl)-3-pyridinyl]-3-[(1-phenylcyclohexyl)methyl]thiourea.
| Compound Name | 1-[6-(2-methylpiperidin-1-yl)-3-pyridinyl]-3-[(1-phenylcyclohexyl)methyl]thiourea |
|---|---|
| PubChem CID | 133149918 |
| Molecular Formula | C25H34N4S |
| Molecular Weight | 422.64 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | 1-[6-(2-methylpiperidin-1-yl)-3-pyridinyl]-3-[(1-phenylcyclohexyl)methyl]thiourea |
| SMILES | CC1CCCCN1c1ccc(NC(=S)NCC2(c3ccccc3)CCCCC2)cn1 |
| InChI | InChI=1S/C25H34N4S/c1-20-10-6-9-17-29(20)23-14-13-22(18-26-23)28-24(30)27-19-25(15-7-3-8-16-25)21-11-4-2-5-12-21/h2,4-5,11-14,18,20H,3,6-10,15-17,19H2,1H3,(H2,27,28,30) |
| InChIKey | GVKZZZJRXPNPIC-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.64 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|