C16H18Cl3F3N2O2 — CID 159497359
2,2,2-trichloroethyl N-[3-(piperidin-1-ylmethyl)-5-(trifluoromethyl)phenyl]carbamate (PubChem CID 159497359) has the molecular formula C16H18Cl3F3N2O2 and a molecular weight of 433.69 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-[3-(piperidin-1-ylmethyl)-5-(trifluoromethyl)phenyl]carbamate.
| Compound Name | 2,2,2-trichloroethyl N-[3-(piperidin-1-ylmethyl)-5-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 159497359 |
| Molecular Formula | C16H18Cl3F3N2O2 |
| Molecular Weight | 433.69 g/mol |
| Exact Mass | 432.04 |
| IUPAC Name | 2,2,2-trichloroethyl N-[3-(piperidin-1-ylmethyl)-5-(trifluoromethyl)phenyl]carbamate |
| SMILES | O=C(Nc1cc(CN2CCCCC2)cc(C(F)(F)F)c1)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H18Cl3F3N2O2/c17-15(18,19)10-26-14(25)23-13-7-11(6-12(8-13)16(20,21)22)9-24-4-2-1-3-5-24/h6-8H,1-5,9-10H2,(H,23,25) |
| InChIKey | LYYJKBQCKAEXFO-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.69 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|