C19H20N2O5 — CID 70846934
5-[(3-tert-butylphenyl)carbamoylamino]benzene-1,3-dicarboxylic acid (PubChem CID 70846934) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is 5-[(3-tert-butylphenyl)carbamoylamino]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[(3-tert-butylphenyl)carbamoylamino]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 70846934 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 5-[(3-tert-butylphenyl)carbamoylamino]benzene-1,3-dicarboxylic acid |
| SMILES | CC(C)(C)c1cccc(NC(=O)Nc2cc(C(=O)O)cc(C(=O)O)c2)c1 |
| InChI | InChI=1S/C19H20N2O5/c1-19(2,3)13-5-4-6-14(10-13)20-18(26)21-15-8-11(16(22)23)7-12(9-15)17(24)25/h4-10H,1-3H3,(H,22,23)(H,24,25)(H2,20,21,26) |
| InChIKey | DJAUQQKOJRUPQD-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |