C13H12N2 — CID 87915213
(1S,5S)-6-(5-ethynyl-3-pyridinyl)-3-azabicyclo[3.2.0]hept-6-ene (PubChem CID 87915213) has the molecular formula C13H12N2 and a molecular weight of 196.25 g/mol. Its IUPAC name is (1S,5S)-6-(5-ethynyl-3-pyridinyl)-3-azabicyclo[3.2.0]hept-6-ene.
| Compound Name | (1S,5S)-6-(5-ethynyl-3-pyridinyl)-3-azabicyclo[3.2.0]hept-6-ene |
|---|---|
| PubChem CID | 87915213 |
| Molecular Formula | C13H12N2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | (1S,5S)-6-(5-ethynyl-3-pyridinyl)-3-azabicyclo[3.2.0]hept-6-ene |
| SMILES | C#Cc1cncc(C2=C[C@@H]3CNC[C@H]23)c1 |
| InChI | InChI=1S/C13H12N2/c1-2-9-3-10(6-14-5-9)12-4-11-7-15-8-13(11)12/h1,3-6,11,13,15H,7-8H2/t11-,13+/m1/s1 |
| InChIKey | OWTSHPDRUNYZMS-YPMHNXCESA-N |
| XLogP | 1.30 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|