C11H7ClF2N2 — CID 107476818
3-(2-chloro-4,5-difluorophenyl)pyridin-2-amine (PubChem CID 107476818) has the molecular formula C11H7ClF2N2 and a molecular weight of 240.64 g/mol. Its IUPAC name is 3-(2-chloro-4,5-difluorophenyl)pyridin-2-amine.
| Compound Name | 3-(2-chloro-4,5-difluorophenyl)pyridin-2-amine |
|---|---|
| PubChem CID | 107476818 |
| Molecular Formula | C11H7ClF2N2 |
| Molecular Weight | 240.64 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | 3-(2-chloro-4,5-difluorophenyl)pyridin-2-amine |
| SMILES | Nc1ncccc1-c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C11H7ClF2N2/c12-8-5-10(14)9(13)4-7(8)6-2-1-3-16-11(6)15/h1-5H,(H2,15,16) |
| InChIKey | ZGTNSXNDPAFKOC-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.64 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|