C7H7ClN4S — CID 114663431
5-(4-chloro-1-methylpyrazol-5-yl)-1,3-thiazol-2-amine (PubChem CID 114663431) has the molecular formula C7H7ClN4S and a molecular weight of 214.68 g/mol. Its IUPAC name is 5-(4-chloro-1-methylpyrazol-5-yl)-1,3-thiazol-2-amine.
| Compound Name | 5-(4-chloro-1-methylpyrazol-5-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 114663431 |
| Molecular Formula | C7H7ClN4S |
| Molecular Weight | 214.68 g/mol |
| Exact Mass | 214.01 |
| IUPAC Name | 5-(4-chloro-1-methylpyrazol-5-yl)-1,3-thiazol-2-amine |
| SMILES | Cn1ncc(Cl)c1-c1cnc(N)s1 |
| InChI | InChI=1S/C7H7ClN4S/c1-12-6(4(8)2-11-12)5-3-10-7(9)13-5/h2-3H,1H3,(H2,9,10) |
| InChIKey | DQEYNUGUQKAHAE-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.68 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |