C9H11ClN4S — CID 114663437
5-(4-chloro-1-propylpyrazol-5-yl)-1,3-thiazol-2-amine (PubChem CID 114663437) has the molecular formula C9H11ClN4S and a molecular weight of 242.74 g/mol. Its IUPAC name is 5-(4-chloro-1-propylpyrazol-5-yl)-1,3-thiazol-2-amine.
| Compound Name | 5-(4-chloro-1-propylpyrazol-5-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 114663437 |
| Molecular Formula | C9H11ClN4S |
| Molecular Weight | 242.74 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | 5-(4-chloro-1-propylpyrazol-5-yl)-1,3-thiazol-2-amine |
| SMILES | CCCn1ncc(Cl)c1-c1cnc(N)s1 |
| InChI | InChI=1S/C9H11ClN4S/c1-2-3-14-8(6(10)4-13-14)7-5-12-9(11)15-7/h4-5H,2-3H2,1H3,(H2,11,12) |
| InChIKey | CIXHDHFYPIBNFY-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.74 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |