C12H10ClN5S — CID 141465288
5-[1-(2-chloro-6-methylphenyl)triazol-4-yl]-1,3-thiazol-2-amine (PubChem CID 141465288) has the molecular formula C12H10ClN5S and a molecular weight of 291.77 g/mol. Its IUPAC name is 5-[1-(2-chloro-6-methylphenyl)triazol-4-yl]-1,3-thiazol-2-amine.
| Compound Name | 5-[1-(2-chloro-6-methylphenyl)triazol-4-yl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 141465288 |
| Molecular Formula | C12H10ClN5S |
| Molecular Weight | 291.77 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | 5-[1-(2-chloro-6-methylphenyl)triazol-4-yl]-1,3-thiazol-2-amine |
| SMILES | Cc1cccc(Cl)c1-n1cc(-c2cnc(N)s2)nn1 |
| InChI | InChI=1S/C12H10ClN5S/c1-7-3-2-4-8(13)11(7)18-6-9(16-17-18)10-5-15-12(14)19-10/h2-6H,1H3,(H2,14,15) |
| InChIKey | YSUGFKHAQGWBFN-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.77 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |