C9H10N4S — CID 144794204
ethene;5-pyridazin-3-yl-1,3-thiazol-2-amine (PubChem CID 144794204) has the molecular formula C9H10N4S and a molecular weight of 206.27 g/mol. Its IUPAC name is ethene;5-pyridazin-3-yl-1,3-thiazol-2-amine.
| Compound Name | ethene;5-pyridazin-3-yl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 144794204 |
| Molecular Formula | C9H10N4S |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | ethene;5-pyridazin-3-yl-1,3-thiazol-2-amine |
| SMILES | C=C.Nc1ncc(-c2cccnn2)s1 |
| InChI | InChI=1S/C7H6N4S.C2H4/c8-7-9-4-6(12-7)5-2-1-3-10-11-5;1-2/h1-4H,(H2,8,9);1-2H2 |
| InChIKey | HHVYGLFTXPJWOW-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|