C6H5N5S — CID 119085384
5-pyridazin-3-yl-1,3,4-thiadiazol-2-amine (PubChem CID 119085384) has the molecular formula C6H5N5S and a molecular weight of 179.21 g/mol. Its IUPAC name is 5-pyridazin-3-yl-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-pyridazin-3-yl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 119085384 |
| Molecular Formula | C6H5N5S |
| Molecular Weight | 179.21 g/mol |
| Exact Mass | 179.03 |
| IUPAC Name | 5-pyridazin-3-yl-1,3,4-thiadiazol-2-amine |
| SMILES | Nc1nnc(-c2cccnn2)s1 |
| InChI | InChI=1S/C6H5N5S/c7-6-11-10-5(12-6)4-2-1-3-8-9-4/h1-3H,(H2,7,11) |
| InChIKey | FWWNUOOWEFRXMW-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.21 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |