About 5-(5-methoxy-1,3-dimethylpyrazol-4-yl)-1,3-thiazol-2-amine
5-(5-methoxy-1,3-dimethylpyrazol-4-yl)-1,3-thiazol-2-amine (PubChem CID 116811786) has the molecular formula C9H12N4OS
and a molecular weight of 224.29 g/mol. Its IUPAC name is 5-(5-methoxy-1,3-dimethylpyrazol-4-yl)-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 5-(5-methoxy-1,3-dimethylpyrazol-4-yl)-1,3-thiazol-2-amine |
| PubChem CID | 116811786 |
| Molecular Formula | C9H12N4OS |
| Molecular Weight | 224.29 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 5-(5-methoxy-1,3-dimethylpyrazol-4-yl)-1,3-thiazol-2-amine |
| SMILES | COc1c(-c2cnc(N)s2)c(C)nn1C |
| InChI | InChI=1S/C9H12N4OS/c1-5-7(6-4-11-9(10)15-6)8(14-3)13(2)12-5/h4H,1-3H3,(H2,10,11) |
| InChIKey | PWNGZCNUEYLQQQ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.29 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(5-methoxy-1,3-dimethylpyrazol-4-yl)-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5-methoxy-1,3-dimethylpyrazol-4-yl)-1,3-thiazol-2-amine?
The IUPAC name of 5-(5-methoxy-1,3-dimethylpyrazol-4-yl)-1,3-thiazol-2-amine (CID 116811786) is 5-(5-methoxy-1,3-dimethylpyrazol-4-yl)-1,3-thiazol-2-amine.
What is the SMILES notation for 5-(5-methoxy-1,3-dimethylpyrazol-4-yl)-1,3-thiazol-2-amine?
The canonical SMILES for 5-(5-methoxy-1,3-dimethylpyrazol-4-yl)-1,3-thiazol-2-amine is COc1c(-c2cnc(N)s2)c(C)nn1C.
What is the InChIKey of 5-(5-methoxy-1,3-dimethylpyrazol-4-yl)-1,3-thiazol-2-amine?
The InChIKey is PWNGZCNUEYLQQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4OS/c1-5-7(6-4-11-9(10)15-6)8(14-3)13(2)12-5/h4H,1-3H3,(H2,10,11).
What are the key properties of 5-(5-methoxy-1,3-dimethylpyrazol-4-yl)-1,3-thiazol-2-amine?
5-(5-methoxy-1,3-dimethylpyrazol-4-yl)-1,3-thiazol-2-amine has a molecular weight of 224.29 g/mol, XLogP of 1.44, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-methoxy-1,3-dimethylpyrazol-4-yl)-1,3-thiazol-2-amine is sourced from PubChem (CID 116811786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).