C11H13IN4O2 — CID 136980141
5-iodo-2-(5-methoxy-1,3-dimethylpyrazol-4-yl)-4-methyl-1H-pyrimidin-6-one (PubChem CID 136980141) has the molecular formula C11H13IN4O2 and a molecular weight of 360.16 g/mol. Its IUPAC name is 5-iodo-2-(5-methoxy-1,3-dimethylpyrazol-4-yl)-4-methyl-1H-pyrimidin-6-one.
| Compound Name | 5-iodo-2-(5-methoxy-1,3-dimethylpyrazol-4-yl)-4-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136980141 |
| Molecular Formula | C11H13IN4O2 |
| Molecular Weight | 360.16 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | 5-iodo-2-(5-methoxy-1,3-dimethylpyrazol-4-yl)-4-methyl-1H-pyrimidin-6-one |
| SMILES | COc1c(-c2nc(C)c(I)c(=O)[nH]2)c(C)nn1C |
| InChI | InChI=1S/C11H13IN4O2/c1-5-7(11(18-4)16(3)15-5)9-13-6(2)8(12)10(17)14-9/h1-4H3,(H,13,14,17) |
| InChIKey | LHARUJGJPQZHGF-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.16 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|