C9H8IN3O — CID 136984656
5-iodo-4-methyl-2-(1H-pyrrol-2-yl)-1H-pyrimidin-6-one (PubChem CID 136984656) has the molecular formula C9H8IN3O and a molecular weight of 301.09 g/mol. Its IUPAC name is 5-iodo-4-methyl-2-(1H-pyrrol-2-yl)-1H-pyrimidin-6-one.
| Compound Name | 5-iodo-4-methyl-2-(1H-pyrrol-2-yl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136984656 |
| Molecular Formula | C9H8IN3O |
| Molecular Weight | 301.09 g/mol |
| Exact Mass | 300.97 |
| IUPAC Name | 5-iodo-4-methyl-2-(1H-pyrrol-2-yl)-1H-pyrimidin-6-one |
| SMILES | Cc1nc(-c2ccc[nH]2)[nH]c(=O)c1I |
| InChI | InChI=1S/C9H8IN3O/c1-5-7(10)9(14)13-8(12-5)6-3-2-4-11-6/h2-4,11H,1H3,(H,12,13,14) |
| InChIKey | MWBGSJDIGSKZRB-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.09 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|