C9H5BrClIN2OS — CID 136683089
2-(4-bromo-5-chlorothiophen-2-yl)-5-iodo-4-methyl-1H-pyrimidin-6-one (PubChem CID 136683089) has the molecular formula C9H5BrClIN2OS and a molecular weight of 431.48 g/mol. Its IUPAC name is 2-(4-bromo-5-chlorothiophen-2-yl)-5-iodo-4-methyl-1H-pyrimidin-6-one.
| Compound Name | 2-(4-bromo-5-chlorothiophen-2-yl)-5-iodo-4-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136683089 |
| Molecular Formula | C9H5BrClIN2OS |
| Molecular Weight | 431.48 g/mol |
| Exact Mass | 429.80 |
| IUPAC Name | 2-(4-bromo-5-chlorothiophen-2-yl)-5-iodo-4-methyl-1H-pyrimidin-6-one |
| SMILES | Cc1nc(-c2cc(Br)c(Cl)s2)[nH]c(=O)c1I |
| InChI | InChI=1S/C9H5BrClIN2OS/c1-3-6(12)9(15)14-8(13-3)5-2-4(10)7(11)16-5/h2H,1H3,(H,13,14,15) |
| InChIKey | WYIOGJYHIHFFIG-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.48 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|