C12H15IN4O2 — CID 136920223
2-(3-ethyl-1-methylpyrazol-4-yl)-5-iodo-4-(methoxymethyl)-1H-pyrimidin-6-one (PubChem CID 136920223) has the molecular formula C12H15IN4O2 and a molecular weight of 374.18 g/mol. Its IUPAC name is 2-(3-ethyl-1-methylpyrazol-4-yl)-5-iodo-4-(methoxymethyl)-1H-pyrimidin-6-one.
| Compound Name | 2-(3-ethyl-1-methylpyrazol-4-yl)-5-iodo-4-(methoxymethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136920223 |
| Molecular Formula | C12H15IN4O2 |
| Molecular Weight | 374.18 g/mol |
| Exact Mass | 374.02 |
| IUPAC Name | 2-(3-ethyl-1-methylpyrazol-4-yl)-5-iodo-4-(methoxymethyl)-1H-pyrimidin-6-one |
| SMILES | CCc1nn(C)cc1-c1nc(COC)c(I)c(=O)[nH]1 |
| InChI | InChI=1S/C12H15IN4O2/c1-4-8-7(5-17(2)16-8)11-14-9(6-19-3)10(13)12(18)15-11/h5H,4,6H2,1-3H3,(H,14,15,18) |
| InChIKey | HJMJDEYVWDVUSG-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.18 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|