C13H12BrIN2O — CID 136980706
2-(4-bromo-2-methylphenyl)-4-ethyl-5-iodo-1H-pyrimidin-6-one (PubChem CID 136980706) has the molecular formula C13H12BrIN2O and a molecular weight of 419.06 g/mol. Its IUPAC name is 2-(4-bromo-2-methylphenyl)-4-ethyl-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 2-(4-bromo-2-methylphenyl)-4-ethyl-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136980706 |
| Molecular Formula | C13H12BrIN2O |
| Molecular Weight | 419.06 g/mol |
| Exact Mass | 417.92 |
| IUPAC Name | 2-(4-bromo-2-methylphenyl)-4-ethyl-5-iodo-1H-pyrimidin-6-one |
| SMILES | CCc1nc(-c2ccc(Br)cc2C)[nH]c(=O)c1I |
| InChI | InChI=1S/C13H12BrIN2O/c1-3-10-11(15)13(18)17-12(16-10)9-5-4-8(14)6-7(9)2/h4-6H,3H2,1-2H3,(H,16,17,18) |
| InChIKey | MCDQQUUHWSLVHA-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.06 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|