C8H10N6O2 — CID 137429401
5-methoxy-4-methyl-2-(2-methyltetrazol-5-yl)-1H-pyrimidin-6-one (PubChem CID 137429401) has the molecular formula C8H10N6O2 and a molecular weight of 222.21 g/mol. Its IUPAC name is 5-methoxy-4-methyl-2-(2-methyltetrazol-5-yl)-1H-pyrimidin-6-one.
| Compound Name | 5-methoxy-4-methyl-2-(2-methyltetrazol-5-yl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137429401 |
| Molecular Formula | C8H10N6O2 |
| Molecular Weight | 222.21 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 5-methoxy-4-methyl-2-(2-methyltetrazol-5-yl)-1H-pyrimidin-6-one |
| SMILES | COc1c(C)nc(-c2nnn(C)n2)[nH]c1=O |
| InChI | InChI=1S/C8H10N6O2/c1-4-5(16-3)8(15)10-6(9-4)7-11-13-14(2)12-7/h1-3H3,(H,9,10,15) |
| InChIKey | FAHCEDBLLHIGDD-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.21 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |