C11H14N4O — CID 14981819
5-(4-methoxy-3,5-dimethylphenyl)-2-methyltetrazole (PubChem CID 14981819) has the molecular formula C11H14N4O and a molecular weight of 218.26 g/mol. Its IUPAC name is 5-(4-methoxy-3,5-dimethylphenyl)-2-methyltetrazole.
| Compound Name | 5-(4-methoxy-3,5-dimethylphenyl)-2-methyltetrazole |
|---|---|
| PubChem CID | 14981819 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 5-(4-methoxy-3,5-dimethylphenyl)-2-methyltetrazole |
| SMILES | COc1c(C)cc(-c2nnn(C)n2)cc1C |
| InChI | InChI=1S/C11H14N4O/c1-7-5-9(6-8(2)10(7)16-4)11-12-14-15(3)13-11/h5-6H,1-4H3 |
| InChIKey | HIMAWTSJVWZMFX-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |