C16H22N4O3 — CID 22103428
ethyl 4-[2,6-dimethyl-4-(2-methyltetrazol-5-yl)phenoxy]butanoate (PubChem CID 22103428) has the molecular formula C16H22N4O3 and a molecular weight of 318.38 g/mol. Its IUPAC name is ethyl 4-[2,6-dimethyl-4-(2-methyltetrazol-5-yl)phenoxy]butanoate.
| Compound Name | ethyl 4-[2,6-dimethyl-4-(2-methyltetrazol-5-yl)phenoxy]butanoate |
|---|---|
| PubChem CID | 22103428 |
| Molecular Formula | C16H22N4O3 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | ethyl 4-[2,6-dimethyl-4-(2-methyltetrazol-5-yl)phenoxy]butanoate |
| SMILES | CCOC(=O)CCCOc1c(C)cc(-c2nnn(C)n2)cc1C |
| InChI | InChI=1S/C16H22N4O3/c1-5-22-14(21)7-6-8-23-15-11(2)9-13(10-12(15)3)16-17-19-20(4)18-16/h9-10H,5-8H2,1-4H3 |
| InChIKey | OBXBRUCWOHDNGC-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 79.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|