C16H20FN5O3 — CID 60599335
ethyl 4-[[2-[5-(4-fluoro-3-methylphenyl)tetrazol-2-yl]acetyl]amino]butanoate (PubChem CID 60599335) has the molecular formula C16H20FN5O3 and a molecular weight of 349.37 g/mol. Its IUPAC name is ethyl 4-[[2-[5-(4-fluoro-3-methylphenyl)tetrazol-2-yl]acetyl]amino]butanoate.
| Compound Name | ethyl 4-[[2-[5-(4-fluoro-3-methylphenyl)tetrazol-2-yl]acetyl]amino]butanoate |
|---|---|
| PubChem CID | 60599335 |
| Molecular Formula | C16H20FN5O3 |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | ethyl 4-[[2-[5-(4-fluoro-3-methylphenyl)tetrazol-2-yl]acetyl]amino]butanoate |
| SMILES | CCOC(=O)CCCNC(=O)Cn1nnc(-c2ccc(F)c(C)c2)n1 |
| InChI | InChI=1S/C16H20FN5O3/c1-3-25-15(24)5-4-8-18-14(23)10-22-20-16(19-21-22)12-6-7-13(17)11(2)9-12/h6-7,9H,3-5,8,10H2,1-2H3,(H,18,23) |
| InChIKey | QXTQBXDLJFGIEX-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|