C13H13FN4O — CID 166200587
1-cyclopropyl-2-[5-(4-fluoro-3-methylphenyl)tetrazol-2-yl]ethanone (PubChem CID 166200587) has the molecular formula C13H13FN4O and a molecular weight of 260.27 g/mol. Its IUPAC name is 1-cyclopropyl-2-[5-(4-fluoro-3-methylphenyl)tetrazol-2-yl]ethanone.
| Compound Name | 1-cyclopropyl-2-[5-(4-fluoro-3-methylphenyl)tetrazol-2-yl]ethanone |
|---|---|
| PubChem CID | 166200587 |
| Molecular Formula | C13H13FN4O |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 1-cyclopropyl-2-[5-(4-fluoro-3-methylphenyl)tetrazol-2-yl]ethanone |
| SMILES | Cc1cc(-c2nnn(CC(=O)C3CC3)n2)ccc1F |
| InChI | InChI=1S/C13H13FN4O/c1-8-6-10(4-5-11(8)14)13-15-17-18(16-13)7-12(19)9-2-3-9/h4-6,9H,2-3,7H2,1H3 |
| InChIKey | ABEYCYZEEAGUCC-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |