C11H12FN5O — CID 94216245
(2R)-2-[5-(4-fluoro-3-methylphenyl)tetrazol-2-yl]propanamide (PubChem CID 94216245) has the molecular formula C11H12FN5O and a molecular weight of 249.25 g/mol. Its IUPAC name is (2R)-2-[5-(4-fluoro-3-methylphenyl)tetrazol-2-yl]propanamide.
| Compound Name | (2R)-2-[5-(4-fluoro-3-methylphenyl)tetrazol-2-yl]propanamide |
|---|---|
| PubChem CID | 94216245 |
| Molecular Formula | C11H12FN5O |
| Molecular Weight | 249.25 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | (2R)-2-[5-(4-fluoro-3-methylphenyl)tetrazol-2-yl]propanamide |
| SMILES | Cc1cc(-c2nnn([C@H](C)C(N)=O)n2)ccc1F |
| InChI | InChI=1S/C11H12FN5O/c1-6-5-8(3-4-9(6)12)11-14-16-17(15-11)7(2)10(13)18/h3-5,7H,1-2H3,(H2,13,18)/t7-/m1/s1 |
| InChIKey | COFSWOYPISNMDR-SSDOTTSWSA-N |
| XLogP | 0.83 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.25 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |