C15H18FN5O3 — CID 51096573
methyl 4-[[2-[5-(4-fluoro-3-methylphenyl)tetrazol-2-yl]acetyl]amino]butanoate (PubChem CID 51096573) has the molecular formula C15H18FN5O3 and a molecular weight of 335.34 g/mol. Its IUPAC name is methyl 4-[[2-[5-(4-fluoro-3-methylphenyl)tetrazol-2-yl]acetyl]amino]butanoate.
| Compound Name | methyl 4-[[2-[5-(4-fluoro-3-methylphenyl)tetrazol-2-yl]acetyl]amino]butanoate |
|---|---|
| PubChem CID | 51096573 |
| Molecular Formula | C15H18FN5O3 |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | methyl 4-[[2-[5-(4-fluoro-3-methylphenyl)tetrazol-2-yl]acetyl]amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)Cn1nnc(-c2ccc(F)c(C)c2)n1 |
| InChI | InChI=1S/C15H18FN5O3/c1-10-8-11(5-6-12(10)16)15-18-20-21(19-15)9-13(22)17-7-3-4-14(23)24-2/h5-6,8H,3-4,7,9H2,1-2H3,(H,17,22) |
| InChIKey | GDPQYYXKUHPEMV-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|