C19H21ClN6O — CID 43033026
2-[5-(3-chlorophenyl)tetrazol-2-yl]-N-[3-(N-methylanilino)propyl]acetamide (PubChem CID 43033026) has the molecular formula C19H21ClN6O and a molecular weight of 384.87 g/mol. Its IUPAC name is 2-[5-(3-chlorophenyl)tetrazol-2-yl]-N-[3-(N-methylanilino)propyl]acetamide.
| Compound Name | 2-[5-(3-chlorophenyl)tetrazol-2-yl]-N-[3-(N-methylanilino)propyl]acetamide |
|---|---|
| PubChem CID | 43033026 |
| Molecular Formula | C19H21ClN6O |
| Molecular Weight | 384.87 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 2-[5-(3-chlorophenyl)tetrazol-2-yl]-N-[3-(N-methylanilino)propyl]acetamide |
| SMILES | CN(CCCNC(=O)Cn1nnc(-c2cccc(Cl)c2)n1)c1ccccc1 |
| InChI | InChI=1S/C19H21ClN6O/c1-25(17-9-3-2-4-10-17)12-6-11-21-18(27)14-26-23-19(22-24-26)15-7-5-8-16(20)13-15/h2-5,7-10,13H,6,11-12,14H2,1H3,(H,21,27) |
| InChIKey | BJGYRISRNSCYRY-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.87 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|