C19H20ClN5O — CID 7490784
2-[5-(3-chlorophenyl)tetrazol-2-yl]-N-[(2S)-4-phenylbutan-2-yl]acetamide (PubChem CID 7490784) has the molecular formula C19H20ClN5O and a molecular weight of 369.86 g/mol. Its IUPAC name is 2-[5-(3-chlorophenyl)tetrazol-2-yl]-N-[(2S)-4-phenylbutan-2-yl]acetamide.
| Compound Name | 2-[5-(3-chlorophenyl)tetrazol-2-yl]-N-[(2S)-4-phenylbutan-2-yl]acetamide |
|---|---|
| PubChem CID | 7490784 |
| Molecular Formula | C19H20ClN5O |
| Molecular Weight | 369.86 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 2-[5-(3-chlorophenyl)tetrazol-2-yl]-N-[(2S)-4-phenylbutan-2-yl]acetamide |
| SMILES | C[C@@H](CCc1ccccc1)NC(=O)Cn1nnc(-c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C19H20ClN5O/c1-14(10-11-15-6-3-2-4-7-15)21-18(26)13-25-23-19(22-24-25)16-8-5-9-17(20)12-16/h2-9,12,14H,10-11,13H2,1H3,(H,21,26)/t14-/m0/s1 |
| InChIKey | SXFDSOWKPDTGOB-AWEZNQCLSA-N |
| XLogP | 3.13 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.86 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |