C18H23IN6O4 — CID 156529829
methyl (2S)-2-[(2-iodoacetyl)amino]-6-[[2-(5-phenyltetrazol-2-yl)acetyl]amino]hexanoate (PubChem CID 156529829) has the molecular formula C18H23IN6O4 and a molecular weight of 514.32 g/mol. Its IUPAC name is methyl (2S)-2-[(2-iodoacetyl)amino]-6-[[2-(5-phenyltetrazol-2-yl)acetyl]amino]hexanoate.
| Compound Name | methyl (2S)-2-[(2-iodoacetyl)amino]-6-[[2-(5-phenyltetrazol-2-yl)acetyl]amino]hexanoate |
|---|---|
| PubChem CID | 156529829 |
| Molecular Formula | C18H23IN6O4 |
| Molecular Weight | 514.32 g/mol |
| Exact Mass | 514.08 |
| IUPAC Name | methyl (2S)-2-[(2-iodoacetyl)amino]-6-[[2-(5-phenyltetrazol-2-yl)acetyl]amino]hexanoate |
| SMILES | COC(=O)[C@H](CCCCNC(=O)Cn1nnc(-c2ccccc2)n1)NC(=O)CI |
| InChI | InChI=1S/C18H23IN6O4/c1-29-18(28)14(21-15(26)11-19)9-5-6-10-20-16(27)12-25-23-17(22-24-25)13-7-3-2-4-8-13/h2-4,7-8,14H,5-6,9-12H2,1H3,(H,20,27)(H,21,26)/t14-/m0/s1 |
| InChIKey | KJXUQLWHHPYYOU-AWEZNQCLSA-N |
| XLogP | 0.72 |
| TPSA | 128.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.32 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|