C15H16N5O2S2+ — CID 163611377
3-[[4-(2-amino-4-methyl-1,3-thiazol-5-yl)-1,3-thiazol-3-ium-2-yl]amino]-4-methoxybenzamide (PubChem CID 163611377) has the molecular formula C15H16N5O2S2+ and a molecular weight of 362.46 g/mol. Its IUPAC name is 3-[[4-(2-amino-4-methyl-1,3-thiazol-5-yl)-1,3-thiazol-3-ium-2-yl]amino]-4-methoxybenzamide.
| Compound Name | 3-[[4-(2-amino-4-methyl-1,3-thiazol-5-yl)-1,3-thiazol-3-ium-2-yl]amino]-4-methoxybenzamide |
|---|---|
| PubChem CID | 163611377 |
| Molecular Formula | C15H16N5O2S2+ |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | 3-[[4-(2-amino-4-methyl-1,3-thiazol-5-yl)-1,3-thiazol-3-ium-2-yl]amino]-4-methoxybenzamide |
| SMILES | COc1ccc(C(N)=O)cc1Nc1[nH+]c(-c2sc(N)nc2C)cs1 |
| InChI | InChI=1S/C15H15N5O2S2/c1-7-12(24-14(17)18-7)10-6-23-15(20-10)19-9-5-8(13(16)21)3-4-11(9)22-2/h3-6H,1-2H3,(H2,16,21)(H2,17,18)(H,19,20)/p+1 |
| InChIKey | HGFGWSVRFRRWDM-UHFFFAOYSA-O |
| XLogP | 2.43 |
| TPSA | 117.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiazole_amine_A(4)', 'substructure': 'N/A'} |
|---|