C14H13ClN4OS2 — CID 87577268
5-[2-amino-5-(5-chloro-2-methoxyphenyl)-1,3-thiazol-4-yl]-4-methyl-1,3-thiazol-2-amine (PubChem CID 87577268) has the molecular formula C14H13ClN4OS2 and a molecular weight of 352.87 g/mol. Its IUPAC name is 5-[2-amino-5-(5-chloro-2-methoxyphenyl)-1,3-thiazol-4-yl]-4-methyl-1,3-thiazol-2-amine.
| Compound Name | 5-[2-amino-5-(5-chloro-2-methoxyphenyl)-1,3-thiazol-4-yl]-4-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 87577268 |
| Molecular Formula | C14H13ClN4OS2 |
| Molecular Weight | 352.87 g/mol |
| Exact Mass | 352.02 |
| IUPAC Name | 5-[2-amino-5-(5-chloro-2-methoxyphenyl)-1,3-thiazol-4-yl]-4-methyl-1,3-thiazol-2-amine |
| SMILES | COc1ccc(Cl)cc1-c1sc(N)nc1-c1sc(N)nc1C |
| InChI | InChI=1S/C14H13ClN4OS2/c1-6-11(21-13(16)18-6)10-12(22-14(17)19-10)8-5-7(15)3-4-9(8)20-2/h3-5H,1-2H3,(H2,16,18)(H2,17,19) |
| InChIKey | QWYACZOUSOODHX-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.87 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiazole_amine_A(4)', 'substructure': 'N/A'} |
|---|