C15H14N4S — CID 91971706
3-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)-4-(trideuterio(113C)methyl)benzene-1,3-diamine (PubChem CID 91971706) has the molecular formula C15H14N4S and a molecular weight of 286.38 g/mol. Its IUPAC name is 3-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)-4-(trideuterio(113C)methyl)benzene-1,3-diamine.
| Compound Name | 3-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)-4-(trideuterio(113C)methyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 91971706 |
| Molecular Formula | C15H14N4S |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 3-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)-4-(trideuterio(113C)methyl)benzene-1,3-diamine |
| SMILES | [2H][13C]([2H])([2H])c1ccc(N)cc1Nc1nc(-c2cccnc2)cs1 |
| InChI | InChI=1S/C15H14N4S/c1-10-4-5-12(16)7-13(10)18-15-19-14(9-20-15)11-3-2-6-17-8-11/h2-9H,16H2,1H3,(H,18,19)/i1+1D3 |
| InChIKey | JKQOCRHWVAAVFB-KQORAOOSSA-N |
| XLogP | 3.84 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|