C19H21N3S — CID 58791492
N-(4-butyl-2-methylphenyl)-4-pyridin-3-yl-1,3-thiazol-2-amine (PubChem CID 58791492) has the molecular formula C19H21N3S and a molecular weight of 323.47 g/mol. Its IUPAC name is N-(4-butyl-2-methylphenyl)-4-pyridin-3-yl-1,3-thiazol-2-amine.
| Compound Name | N-(4-butyl-2-methylphenyl)-4-pyridin-3-yl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 58791492 |
| Molecular Formula | C19H21N3S |
| Molecular Weight | 323.47 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | N-(4-butyl-2-methylphenyl)-4-pyridin-3-yl-1,3-thiazol-2-amine |
| SMILES | CCCCc1ccc(Nc2nc(-c3cccnc3)cs2)c(C)c1 |
| InChI | InChI=1S/C19H21N3S/c1-3-4-6-15-8-9-17(14(2)11-15)21-19-22-18(13-23-19)16-7-5-10-20-12-16/h5,7-13H,3-4,6H2,1-2H3,(H,21,22) |
| InChIKey | CRDQVVAPYMBMKO-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.47 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |