C21H17N3O2S — CID 58791567
N-(2-methoxy-5-phenoxyphenyl)-4-pyridin-3-yl-1,3-thiazol-2-amine (PubChem CID 58791567) has the molecular formula C21H17N3O2S and a molecular weight of 375.45 g/mol. Its IUPAC name is N-(2-methoxy-5-phenoxyphenyl)-4-pyridin-3-yl-1,3-thiazol-2-amine.
| Compound Name | N-(2-methoxy-5-phenoxyphenyl)-4-pyridin-3-yl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 58791567 |
| Molecular Formula | C21H17N3O2S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | N-(2-methoxy-5-phenoxyphenyl)-4-pyridin-3-yl-1,3-thiazol-2-amine |
| SMILES | COc1ccc(Oc2ccccc2)cc1Nc1nc(-c2cccnc2)cs1 |
| InChI | InChI=1S/C21H17N3O2S/c1-25-20-10-9-17(26-16-7-3-2-4-8-16)12-18(20)23-21-24-19(14-27-21)15-6-5-11-22-13-15/h2-14H,1H3,(H,23,24) |
| InChIKey | VVLREFCZBPTTCV-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |