About 4-(3-bromophenyl)-N-(2,5-dimethoxyphenyl)-1,3-thiazol-2-amine
4-(3-bromophenyl)-N-(2,5-dimethoxyphenyl)-1,3-thiazol-2-amine (PubChem CID 53338354) has the molecular formula C17H15BrN2O2S
and a molecular weight of 391.29 g/mol. Its IUPAC name is 4-(3-bromophenyl)-N-(2,5-dimethoxyphenyl)-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 4-(3-bromophenyl)-N-(2,5-dimethoxyphenyl)-1,3-thiazol-2-amine |
| PubChem CID | 53338354 |
| Molecular Formula | C17H15BrN2O2S |
| Molecular Weight | 391.29 g/mol |
| Exact Mass | 390.00 |
| IUPAC Name | 4-(3-bromophenyl)-N-(2,5-dimethoxyphenyl)-1,3-thiazol-2-amine |
| SMILES | COc1ccc(OC)c(Nc2nc(-c3cccc(Br)c3)cs2)c1 |
| InChI | InChI=1S/C17H15BrN2O2S/c1-21-13-6-7-16(22-2)14(9-13)19-17-20-15(10-23-17)11-4-3-5-12(18)8-11/h3-10H,1-2H3,(H,19,20) |
| InChIKey | UNMVZKGCTMFLBJ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.29 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(3-bromophenyl)-N-(2,5-dimethoxyphenyl)-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-bromophenyl)-N-(2,5-dimethoxyphenyl)-1,3-thiazol-2-amine?
The IUPAC name of 4-(3-bromophenyl)-N-(2,5-dimethoxyphenyl)-1,3-thiazol-2-amine (CID 53338354) is 4-(3-bromophenyl)-N-(2,5-dimethoxyphenyl)-1,3-thiazol-2-amine.
What is the SMILES notation for 4-(3-bromophenyl)-N-(2,5-dimethoxyphenyl)-1,3-thiazol-2-amine?
The canonical SMILES for 4-(3-bromophenyl)-N-(2,5-dimethoxyphenyl)-1,3-thiazol-2-amine is COc1ccc(OC)c(Nc2nc(-c3cccc(Br)c3)cs2)c1.
What is the InChIKey of 4-(3-bromophenyl)-N-(2,5-dimethoxyphenyl)-1,3-thiazol-2-amine?
The InChIKey is UNMVZKGCTMFLBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15BrN2O2S/c1-21-13-6-7-16(22-2)14(9-13)19-17-20-15(10-23-17)11-4-3-5-12(18)8-11/h3-10H,1-2H3,(H,19,20).
What are the key properties of 4-(3-bromophenyl)-N-(2,5-dimethoxyphenyl)-1,3-thiazol-2-amine?
4-(3-bromophenyl)-N-(2,5-dimethoxyphenyl)-1,3-thiazol-2-amine has a molecular weight of 391.29 g/mol, XLogP of 5.33, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-bromophenyl)-N-(2,5-dimethoxyphenyl)-1,3-thiazol-2-amine is sourced from PubChem (CID 53338354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).