C22H17N3O2S — CID 87483194
2-[2-phenoxy-5-[(4-pyridin-3-yl-1,3-thiazol-2-yl)amino]phenyl]acetaldehyde (PubChem CID 87483194) has the molecular formula C22H17N3O2S and a molecular weight of 387.46 g/mol. Its IUPAC name is 2-[2-phenoxy-5-[(4-pyridin-3-yl-1,3-thiazol-2-yl)amino]phenyl]acetaldehyde.
| Compound Name | 2-[2-phenoxy-5-[(4-pyridin-3-yl-1,3-thiazol-2-yl)amino]phenyl]acetaldehyde |
|---|---|
| PubChem CID | 87483194 |
| Molecular Formula | C22H17N3O2S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 2-[2-phenoxy-5-[(4-pyridin-3-yl-1,3-thiazol-2-yl)amino]phenyl]acetaldehyde |
| SMILES | O=CCc1cc(Nc2nc(-c3cccnc3)cs2)ccc1Oc1ccccc1 |
| InChI | InChI=1S/C22H17N3O2S/c26-12-10-16-13-18(8-9-21(16)27-19-6-2-1-3-7-19)24-22-25-20(15-28-22)17-5-4-11-23-14-17/h1-9,11-15H,10H2,(H,24,25) |
| InChIKey | WUUADRGFYKMUPF-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|