C19H14N4S — CID 58791761
N-(6-phenyl-3-pyridinyl)-4-pyridin-3-yl-1,3-thiazol-2-amine (PubChem CID 58791761) has the molecular formula C19H14N4S and a molecular weight of 330.42 g/mol. Its IUPAC name is N-(6-phenyl-3-pyridinyl)-4-pyridin-3-yl-1,3-thiazol-2-amine.
| Compound Name | N-(6-phenyl-3-pyridinyl)-4-pyridin-3-yl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 58791761 |
| Molecular Formula | C19H14N4S |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | N-(6-phenyl-3-pyridinyl)-4-pyridin-3-yl-1,3-thiazol-2-amine |
| SMILES | c1ccc(-c2ccc(Nc3nc(-c4cccnc4)cs3)cn2)cc1 |
| InChI | InChI=1S/C19H14N4S/c1-2-5-14(6-3-1)17-9-8-16(12-21-17)22-19-23-18(13-24-19)15-7-4-10-20-11-15/h1-13H,(H,22,23) |
| InChIKey | OCOPIAMMGITCNY-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |