C29H22N6O4S — CID 87578987
phenyl-[[4-[[3-[(4-pyridin-3-yl-1,3-thiazol-2-yl)amino]phenyl]carbamoyl]benzoyl]amino]carbamic acid (PubChem CID 87578987) has the molecular formula C29H22N6O4S and a molecular weight of 550.60 g/mol. Its IUPAC name is phenyl-[[4-[[3-[(4-pyridin-3-yl-1,3-thiazol-2-yl)amino]phenyl]carbamoyl]benzoyl]amino]carbamic acid.
| Compound Name | phenyl-[[4-[[3-[(4-pyridin-3-yl-1,3-thiazol-2-yl)amino]phenyl]carbamoyl]benzoyl]amino]carbamic acid |
|---|---|
| PubChem CID | 87578987 |
| Molecular Formula | C29H22N6O4S |
| Molecular Weight | 550.60 g/mol |
| Exact Mass | 550.14 |
| IUPAC Name | phenyl-[[4-[[3-[(4-pyridin-3-yl-1,3-thiazol-2-yl)amino]phenyl]carbamoyl]benzoyl]amino]carbamic acid |
| SMILES | O=C(Nc1cccc(Nc2nc(-c3cccnc3)cs2)c1)c1ccc(C(=O)NN(C(=O)O)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H22N6O4S/c36-26(19-11-13-20(14-12-19)27(37)34-35(29(38)39)24-9-2-1-3-10-24)31-22-7-4-8-23(16-22)32-28-33-25(18-40-28)21-6-5-15-30-17-21/h1-18H,(H,31,36)(H,32,33)(H,34,37)(H,38,39) |
| InChIKey | BCNLIYAXTPYEGA-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 136.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.60 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|