C21H23ClN4O3 — CID 87637411
N-[3-[[3-chloro-5-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-2-pyridinyl]amino]phenyl]cyclohexanecarboxamide (PubChem CID 87637411) has the molecular formula C21H23ClN4O3 and a molecular weight of 414.89 g/mol. Its IUPAC name is N-[3-[[3-chloro-5-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-2-pyridinyl]amino]phenyl]cyclohexanecarboxamide.
| Compound Name | N-[3-[[3-chloro-5-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-2-pyridinyl]amino]phenyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 87637411 |
| Molecular Formula | C21H23ClN4O3 |
| Molecular Weight | 414.89 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | N-[3-[[3-chloro-5-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-2-pyridinyl]amino]phenyl]cyclohexanecarboxamide |
| SMILES | O=C(/C=C/c1cnc(Nc2cccc(NC(=O)C3CCCCC3)c2)c(Cl)c1)NO |
| InChI | InChI=1S/C21H23ClN4O3/c22-18-11-14(9-10-19(27)26-29)13-23-20(18)24-16-7-4-8-17(12-16)25-21(28)15-5-2-1-3-6-15/h4,7-13,15,29H,1-3,5-6H2,(H,23,24)(H,25,28)(H,26,27)/b10-9+ |
| InChIKey | NDCBUHHPKODWDX-MDZDMXLPSA-N |
| XLogP | 4.52 |
| TPSA | 103.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.89 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|