C17H17Cl2N3O2 — CID 173125303
3-[5-chloro-6-[[(1S,2R)-2-phenylcyclopropyl]amino]-3-pyridinyl]-N-hydroxyprop-2-enamide;hydrochloride (PubChem CID 173125303) has the molecular formula C17H17Cl2N3O2 and a molecular weight of 366.25 g/mol. Its IUPAC name is 3-[5-chloro-6-[[(1S,2R)-2-phenylcyclopropyl]amino]-3-pyridinyl]-N-hydroxyprop-2-enamide;hydrochloride.
| Compound Name | 3-[5-chloro-6-[[(1S,2R)-2-phenylcyclopropyl]amino]-3-pyridinyl]-N-hydroxyprop-2-enamide;hydrochloride |
|---|---|
| PubChem CID | 173125303 |
| Molecular Formula | C17H17Cl2N3O2 |
| Molecular Weight | 366.25 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 3-[5-chloro-6-[[(1S,2R)-2-phenylcyclopropyl]amino]-3-pyridinyl]-N-hydroxyprop-2-enamide;hydrochloride |
| SMILES | Cl.O=C(C=Cc1cnc(N[C@H]2C[C@@H]2c2ccccc2)c(Cl)c1)NO |
| InChI | InChI=1S/C17H16ClN3O2.ClH/c18-14-8-11(6-7-16(22)21-23)10-19-17(14)20-15-9-13(15)12-4-2-1-3-5-12;/h1-8,10,13,15,23H,9H2,(H,19,20)(H,21,22);1H/t13-,15+;/m1./s1 |
| InChIKey | BVMXLZXNQGBGMA-PBCQUBLHSA-N |
| XLogP | 3.64 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.25 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|