C22H33N5O4 — CID 59242176
N-[(2R)-2-[[5-[(E)-3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]pyrazin-2-yl]amino]propyl]cyclohexanecarboxamide (PubChem CID 59242176) has the molecular formula C22H33N5O4 and a molecular weight of 431.54 g/mol. Its IUPAC name is N-[(2R)-2-[[5-[(E)-3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]pyrazin-2-yl]amino]propyl]cyclohexanecarboxamide.
| Compound Name | N-[(2R)-2-[[5-[(E)-3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]pyrazin-2-yl]amino]propyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 59242176 |
| Molecular Formula | C22H33N5O4 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.25 |
| IUPAC Name | N-[(2R)-2-[[5-[(E)-3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]pyrazin-2-yl]amino]propyl]cyclohexanecarboxamide |
| SMILES | C[C@H](CNC(=O)C1CCCCC1)Nc1cnc(/C=C/C(=O)NOC2CCCCO2)cn1 |
| InChI | InChI=1S/C22H33N5O4/c1-16(13-25-22(29)17-7-3-2-4-8-17)26-19-15-23-18(14-24-19)10-11-20(28)27-31-21-9-5-6-12-30-21/h10-11,14-17,21H,2-9,12-13H2,1H3,(H,24,26)(H,25,29)(H,27,28)/b11-10+/t16-,21?/m1/s1 |
| InChIKey | YKRVUTKONQPQDF-GXVQMSIJSA-N |
| XLogP | 2.56 |
| TPSA | 114.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|