C18H28N4O2 — CID 91606424
methyl 3-[5-[[(2R)-1-[cyclohexyl(methyl)amino]propan-2-yl]amino]pyrazin-2-yl]prop-2-enoate (PubChem CID 91606424) has the molecular formula C18H28N4O2 and a molecular weight of 332.45 g/mol. Its IUPAC name is methyl 3-[5-[[(2R)-1-[cyclohexyl(methyl)amino]propan-2-yl]amino]pyrazin-2-yl]prop-2-enoate.
| Compound Name | methyl 3-[5-[[(2R)-1-[cyclohexyl(methyl)amino]propan-2-yl]amino]pyrazin-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 91606424 |
| Molecular Formula | C18H28N4O2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | methyl 3-[5-[[(2R)-1-[cyclohexyl(methyl)amino]propan-2-yl]amino]pyrazin-2-yl]prop-2-enoate |
| SMILES | COC(=O)C=Cc1cnc(N[C@H](C)CN(C)C2CCCCC2)cn1 |
| InChI | InChI=1S/C18H28N4O2/c1-14(13-22(2)16-7-5-4-6-8-16)21-17-12-19-15(11-20-17)9-10-18(23)24-3/h9-12,14,16H,4-8,13H2,1-3H3,(H,20,21)/t14-/m1/s1 |
| InChIKey | CJQRIAFLWUSBLL-CQSZACIVSA-N |
| XLogP | 2.73 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|