C19H24N4O2 — CID 59242422
methyl (E)-3-[5-[[(2R)-1-[benzyl(methyl)amino]propan-2-yl]amino]pyrazin-2-yl]prop-2-enoate (PubChem CID 59242422) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is methyl (E)-3-[5-[[(2R)-1-[benzyl(methyl)amino]propan-2-yl]amino]pyrazin-2-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[5-[[(2R)-1-[benzyl(methyl)amino]propan-2-yl]amino]pyrazin-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 59242422 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | methyl (E)-3-[5-[[(2R)-1-[benzyl(methyl)amino]propan-2-yl]amino]pyrazin-2-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1cnc(N[C@H](C)CN(C)Cc2ccccc2)cn1 |
| InChI | InChI=1S/C19H24N4O2/c1-15(13-23(2)14-16-7-5-4-6-8-16)22-18-12-20-17(11-21-18)9-10-19(24)25-3/h4-12,15H,13-14H2,1-3H3,(H,21,22)/b10-9+/t15-/m1/s1 |
| InChIKey | UYWQGOACCWFUJU-BOLDSZDNSA-N |
| XLogP | 2.60 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|