C14H20N4O2S2 — CID 133435926
2-[1-[benzyl(methyl)amino]propan-2-ylamino]-1,3-thiazole-5-sulfonamide (PubChem CID 133435926) has the molecular formula C14H20N4O2S2 and a molecular weight of 340.47 g/mol. Its IUPAC name is 2-[1-[benzyl(methyl)amino]propan-2-ylamino]-1,3-thiazole-5-sulfonamide.
| Compound Name | 2-[1-[benzyl(methyl)amino]propan-2-ylamino]-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 133435926 |
| Molecular Formula | C14H20N4O2S2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 2-[1-[benzyl(methyl)amino]propan-2-ylamino]-1,3-thiazole-5-sulfonamide |
| SMILES | CC(CN(C)Cc1ccccc1)Nc1ncc(S(N)(=O)=O)s1 |
| InChI | InChI=1S/C14H20N4O2S2/c1-11(9-18(2)10-12-6-4-3-5-7-12)17-14-16-8-13(21-14)22(15,19)20/h3-8,11H,9-10H2,1-2H3,(H,16,17)(H2,15,19,20) |
| InChIKey | QTAAUIZCTOTLBY-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |