C13H12N4O2S3 — CID 133331367
2-[(2-phenyl-1,3-thiazol-4-yl)methylamino]-1,3-thiazole-5-sulfonamide (PubChem CID 133331367) has the molecular formula C13H12N4O2S3 and a molecular weight of 352.47 g/mol. Its IUPAC name is 2-[(2-phenyl-1,3-thiazol-4-yl)methylamino]-1,3-thiazole-5-sulfonamide.
| Compound Name | 2-[(2-phenyl-1,3-thiazol-4-yl)methylamino]-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 133331367 |
| Molecular Formula | C13H12N4O2S3 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | 2-[(2-phenyl-1,3-thiazol-4-yl)methylamino]-1,3-thiazole-5-sulfonamide |
| SMILES | NS(=O)(=O)c1cnc(NCc2csc(-c3ccccc3)n2)s1 |
| InChI | InChI=1S/C13H12N4O2S3/c14-22(18,19)11-7-16-13(21-11)15-6-10-8-20-12(17-10)9-4-2-1-3-5-9/h1-5,7-8H,6H2,(H,15,16)(H2,14,18,19) |
| InChIKey | ZKTNDXSWOQWSGB-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |