C13H12N4O3S2 — CID 86818334
2-[(5-phenyl-1,2-oxazol-3-yl)methylamino]-1,3-thiazole-5-sulfonamide (PubChem CID 86818334) has the molecular formula C13H12N4O3S2 and a molecular weight of 336.40 g/mol. Its IUPAC name is 2-[(5-phenyl-1,2-oxazol-3-yl)methylamino]-1,3-thiazole-5-sulfonamide.
| Compound Name | 2-[(5-phenyl-1,2-oxazol-3-yl)methylamino]-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 86818334 |
| Molecular Formula | C13H12N4O3S2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 2-[(5-phenyl-1,2-oxazol-3-yl)methylamino]-1,3-thiazole-5-sulfonamide |
| SMILES | NS(=O)(=O)c1cnc(NCc2cc(-c3ccccc3)on2)s1 |
| InChI | InChI=1S/C13H12N4O3S2/c14-22(18,19)12-8-16-13(21-12)15-7-10-6-11(20-17-10)9-4-2-1-3-5-9/h1-6,8H,7H2,(H,15,16)(H2,14,18,19) |
| InChIKey | MVUKWQXCWSETRL-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |