C13H14N2O — CID 162624310
N-[(5-phenyl-1,2-oxazol-3-yl)methyl]prop-2-en-1-amine (PubChem CID 162624310) has the molecular formula C13H14N2O and a molecular weight of 214.27 g/mol. Its IUPAC name is N-[(5-phenyl-1,2-oxazol-3-yl)methyl]prop-2-en-1-amine.
| Compound Name | N-[(5-phenyl-1,2-oxazol-3-yl)methyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 162624310 |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | N-[(5-phenyl-1,2-oxazol-3-yl)methyl]prop-2-en-1-amine |
| SMILES | C=CCNCc1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C13H14N2O/c1-2-8-14-10-12-9-13(16-15-12)11-6-4-3-5-7-11/h2-7,9,14H,1,8,10H2 |
| InChIKey | KWTNMZSJFMYZGF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|