C15H18N2O — CID 170752500
N-[(5-phenyl-1,2-oxazol-3-yl)methyl]cyclopentanamine (PubChem CID 170752500) has the molecular formula C15H18N2O and a molecular weight of 242.32 g/mol. Its IUPAC name is N-[(5-phenyl-1,2-oxazol-3-yl)methyl]cyclopentanamine.
| Compound Name | N-[(5-phenyl-1,2-oxazol-3-yl)methyl]cyclopentanamine |
|---|---|
| PubChem CID | 170752500 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | N-[(5-phenyl-1,2-oxazol-3-yl)methyl]cyclopentanamine |
| SMILES | c1ccc(-c2cc(CNC3CCCC3)no2)cc1 |
| InChI | InChI=1S/C15H18N2O/c1-2-6-12(7-3-1)15-10-14(17-18-15)11-16-13-8-4-5-9-13/h1-3,6-7,10,13,16H,4-5,8-9,11H2 |
| InChIKey | RTMHZRJXNWURBF-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |