C17H18N2O3 — CID 167840679
(1R,6S)-6-[(5-phenyl-1,2-oxazol-3-yl)methylamino]cyclohex-3-ene-1-carboxylic acid (PubChem CID 167840679) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is (1R,6S)-6-[(5-phenyl-1,2-oxazol-3-yl)methylamino]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1R,6S)-6-[(5-phenyl-1,2-oxazol-3-yl)methylamino]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 167840679 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | (1R,6S)-6-[(5-phenyl-1,2-oxazol-3-yl)methylamino]cyclohex-3-ene-1-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CC=CC[C@@H]1NCc1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C17H18N2O3/c20-17(21)14-8-4-5-9-15(14)18-11-13-10-16(22-19-13)12-6-2-1-3-7-12/h1-7,10,14-15,18H,8-9,11H2,(H,20,21)/t14-,15+/m1/s1 |
| InChIKey | ZELGOWYBUSDGNE-CABCVRRESA-N |
| XLogP | 2.85 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|