C16H20N2O — CID 170752624
N-[(5-phenyl-1,2-oxazol-3-yl)methyl]cyclohexanamine (PubChem CID 170752624) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is N-[(5-phenyl-1,2-oxazol-3-yl)methyl]cyclohexanamine.
| Compound Name | N-[(5-phenyl-1,2-oxazol-3-yl)methyl]cyclohexanamine |
|---|---|
| PubChem CID | 170752624 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | N-[(5-phenyl-1,2-oxazol-3-yl)methyl]cyclohexanamine |
| SMILES | c1ccc(-c2cc(CNC3CCCCC3)no2)cc1 |
| InChI | InChI=1S/C16H20N2O/c1-3-7-13(8-4-1)16-11-15(18-19-16)12-17-14-9-5-2-6-10-14/h1,3-4,7-8,11,14,17H,2,5-6,9-10,12H2 |
| InChIKey | PIPYAHNOOYVWBG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |